C30H31F5O — CID 22883418
5-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-1,2,3-trifluorobenzene (PubChem CID 22883418) has the molecular formula C30H31F5O and a molecular weight of 502.57 g/mol. Its IUPAC name is 5-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 22883418 |
| Molecular Formula | C30H31F5O |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 5-[2-[difluoro-[4-(4-pentylcyclohexyl)phenyl]methoxy]phenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCCCC1CCC(c2ccc(C(F)(F)Oc3ccccc3-c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C30H31F5O/c1-2-3-4-7-20-10-12-21(13-11-20)22-14-16-24(17-15-22)30(34,35)36-28-9-6-5-8-25(28)23-18-26(31)29(33)27(32)19-23/h5-6,8-9,14-21H,2-4,7,10-13H2,1H3 |
| InChIKey | VNLMQRWKJCDGED-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|