C28H27F5 — CID 118912527
1-[4-(4-butylcyclohexyl)phenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene (PubChem CID 118912527) has the molecular formula C28H27F5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 1-[4-(4-butylcyclohexyl)phenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1-[4-(4-butylcyclohexyl)phenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 118912527 |
| Molecular Formula | C28H27F5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-[4-(4-butylcyclohexyl)phenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C28H27F5/c1-2-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)22-13-14-23(27(32)26(22)31)21-15-24(29)28(33)25(30)16-21/h9-18H,2-8H2,1H3 |
| InChIKey | UHNMDEYHSRPWAS-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|