About CID 162030737
CID 162030737 (PubChem CID 162030737) has the molecular formula C27H37BF3
and a molecular weight of 429.40 g/mol.
Molecular Properties
| Compound Name | CID 162030737 |
| PubChem CID | 162030737 |
| Molecular Formula | C27H37BF3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | — |
| SMILES | CCCCCCCC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)cc2)CC1.C[B]C |
| InChI | InChI=1S/C25H31F3.C2H6B/c1-2-3-4-5-6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-16-23(26)25(28)24(27)17-22;1-3-2/h12-19H,2-11H2,1H3;1-2H3 |
| InChIKey | FNJFIZTVXVBOLA-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162030737 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162030737?
The IUPAC name of CID 162030737 (CID 162030737) is not available.
What is the SMILES notation for CID 162030737?
The canonical SMILES for CID 162030737 is CCCCCCCC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)cc2)CC1.C[B]C.
What is the InChIKey of CID 162030737?
The InChIKey is FNJFIZTVXVBOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31F3.C2H6B/c1-2-3-4-5-6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-16-23(26)25(28)24(27)17-22;1-3-2/h12-19H,2-11H2,1H3;1-2H3.
What are the key properties of CID 162030737?
CID 162030737 has a molecular weight of 429.40 g/mol, XLogP of 9.19, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162030737 is sourced from PubChem (CID 162030737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).