C28H27F5O — CID 67595250
1-[4-(4-butylcyclohexyl)phenyl]-3,4-difluoro-2-(3,4,5-trifluorophenoxy)benzene (PubChem CID 67595250) has the molecular formula C28H27F5O and a molecular weight of 474.51 g/mol. Its IUPAC name is 1-[4-(4-butylcyclohexyl)phenyl]-3,4-difluoro-2-(3,4,5-trifluorophenoxy)benzene.
| Compound Name | 1-[4-(4-butylcyclohexyl)phenyl]-3,4-difluoro-2-(3,4,5-trifluorophenoxy)benzene |
|---|---|
| PubChem CID | 67595250 |
| Molecular Formula | C28H27F5O |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[4-(4-butylcyclohexyl)phenyl]-3,4-difluoro-2-(3,4,5-trifluorophenoxy)benzene |
| SMILES | CCCCC1CCC(c2ccc(-c3ccc(F)c(F)c3Oc3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C28H27F5O/c1-2-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)22-13-14-23(29)27(33)28(22)34-21-15-24(30)26(32)25(31)16-21/h9-18H,2-8H2,1H3 |
| InChIKey | PTGXNLGVWVZKDF-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|