C37H36F6 — CID 118859045
2,3-difluoro-1-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-[4-(4-pentylcyclohexyl)phenyl]benzene (PubChem CID 118859045) has the molecular formula C37H36F6 and a molecular weight of 594.68 g/mol. Its IUPAC name is 2,3-difluoro-1-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-[4-(4-pentylcyclohexyl)phenyl]benzene.
| Compound Name | 2,3-difluoro-1-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-[4-(4-pentylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 118859045 |
| Molecular Formula | C37H36F6 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 2,3-difluoro-1-[2-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]ethyl]-4-[4-(4-pentylcyclohexyl)phenyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(CCc4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C37H36F6/c1-2-3-4-5-23-6-10-25(11-7-23)26-13-15-27(16-14-26)31-19-17-28(35(41)36(31)42)12-8-24-9-18-30(32(38)20-24)29-21-33(39)37(43)34(40)22-29/h9,13-23,25H,2-8,10-12H2,1H3 |
| InChIKey | UHEZXHIICXGGDH-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|