C31H33F5 — CID 118858890
2,3-difluoro-1-(4-pentylcyclohexyl)-4-[4-[2-(3,4,5-trifluorophenyl)ethyl]phenyl]benzene (PubChem CID 118858890) has the molecular formula C31H33F5 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-pentylcyclohexyl)-4-[4-[2-(3,4,5-trifluorophenyl)ethyl]phenyl]benzene.
| Compound Name | 2,3-difluoro-1-(4-pentylcyclohexyl)-4-[4-[2-(3,4,5-trifluorophenyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 118858890 |
| Molecular Formula | C31H33F5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2,3-difluoro-1-(4-pentylcyclohexyl)-4-[4-[2-(3,4,5-trifluorophenyl)ethyl]phenyl]benzene |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(CCc4cc(F)c(F)c(F)c4)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C31H33F5/c1-2-3-4-5-20-8-12-23(13-9-20)25-16-17-26(30(35)29(25)34)24-14-10-21(11-15-24)6-7-22-18-27(32)31(36)28(33)19-22/h10-11,14-20,23H,2-9,12-13H2,1H3 |
| InChIKey | LJASWGIMOJEGMT-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|