C27H26F6 — CID 118593563
6-[2,3-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 118593563) has the molecular formula C27H26F6 and a molecular weight of 464.49 g/mol. Its IUPAC name is 6-[2,3-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[2,3-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 118593563 |
| Molecular Formula | C27H26F6 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 6-[2,3-difluoro-4-(4-pentylcyclohexyl)phenyl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCCCC1CCC(c2ccc(-c3cc(F)c4c(F)c(F)c(F)cc4c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C27H26F6/c1-2-3-4-5-15-6-8-16(9-7-15)19-10-11-20(25(31)24(19)30)17-12-18-14-22(29)26(32)27(33)23(18)21(28)13-17/h10-16H,2-9H2,1H3 |
| InChIKey | QGIBGIISGUIHAB-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|