C20H19F5 — CID 118593478
1-(4-ethylcyclohexyl)-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene (PubChem CID 118593478) has the molecular formula C20H19F5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1-(4-ethylcyclohexyl)-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 118593478 |
| Molecular Formula | C20H19F5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
| SMILES | CCC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H19F5/c1-2-11-3-5-12(6-4-11)14-7-8-15(19(24)18(14)23)13-9-16(21)20(25)17(22)10-13/h7-12H,2-6H2,1H3 |
| InChIKey | IWUYHPDARUXSCD-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|