C29H28F4O — CID 67730976
1-[4-[2,3-difluoro-4-[(Z)-prop-1-enoxy]phenyl]phenyl]-4-(4-ethylcyclohexyl)-2,3-difluorobenzene (PubChem CID 67730976) has the molecular formula C29H28F4O and a molecular weight of 468.53 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[(Z)-prop-1-enoxy]phenyl]phenyl]-4-(4-ethylcyclohexyl)-2,3-difluorobenzene.
| Compound Name | 1-[4-[2,3-difluoro-4-[(Z)-prop-1-enoxy]phenyl]phenyl]-4-(4-ethylcyclohexyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67730976 |
| Molecular Formula | C29H28F4O |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[(Z)-prop-1-enoxy]phenyl]phenyl]-4-(4-ethylcyclohexyl)-2,3-difluorobenzene |
| SMILES | C/C=C\Oc1ccc(-c2ccc(-c3ccc(C4CCC(CC)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C29H28F4O/c1-3-17-34-25-16-15-24(28(32)29(25)33)21-11-9-20(10-12-21)23-14-13-22(26(30)27(23)31)19-7-5-18(4-2)6-8-19/h3,9-19H,4-8H2,1-2H3/b17-3- |
| InChIKey | YAXDQXCWFATULK-YPEHOIGNSA-N |
| XLogP | 9.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|