C39H46F4O — CID 77345581
1-but-1-enoxy-4-[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene (PubChem CID 77345581) has the molecular formula C39H46F4O and a molecular weight of 606.79 g/mol. Its IUPAC name is 1-but-1-enoxy-4-[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-but-1-enoxy-4-[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 77345581 |
| Molecular Formula | C39H46F4O |
| Molecular Weight | 606.79 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | 1-but-1-enoxy-4-[4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-2,3-difluorobenzene |
| SMILES | CCC=COc1ccc(-c2ccc(-c3ccc(C4CCC(C5CCC(CCCCC)CC5)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C39H46F4O/c1-3-5-7-8-26-9-11-27(12-10-26)28-13-15-29(16-14-28)32-21-22-33(37(41)36(32)40)30-17-19-31(20-18-30)34-23-24-35(39(43)38(34)42)44-25-6-4-2/h6,17-29H,3-5,7-16H2,1-2H3 |
| InChIKey | RBGZFAYNZNILSV-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.79 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|