C38H46F4O — CID 67731026
1-[4-[2,3-difluoro-4-(4-nonylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene (PubChem CID 67731026) has the molecular formula C38H46F4O and a molecular weight of 594.78 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-(4-nonylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene.
| Compound Name | 1-[4-[2,3-difluoro-4-(4-nonylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene |
|---|---|
| PubChem CID | 67731026 |
| Molecular Formula | C38H46F4O |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-(4-nonylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-[(E)-pent-2-enoxy]benzene |
| SMILES | CC/C=C/COc1ccc(-c2ccc(-c3ccc(C4CCC(CCCCCCCCC)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C38H46F4O/c1-3-5-7-8-9-10-11-13-27-14-16-28(17-15-27)31-22-23-32(36(40)35(31)39)29-18-20-30(21-19-29)33-24-25-34(38(42)37(33)41)43-26-12-6-4-2/h6,12,18-25,27-28H,3-5,7-11,13-17,26H2,1-2H3/b12-6+ |
| InChIKey | CAKQWGPUFHPTSC-WUXMJOGZSA-N |
| XLogP | 12.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|