C34H38F4O — CID 77343618
1-[4-[2,3-difluoro-4-(4-pent-3-enylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene (PubChem CID 77343618) has the molecular formula C34H38F4O and a molecular weight of 538.67 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-(4-pent-3-enylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene.
| Compound Name | 1-[4-[2,3-difluoro-4-(4-pent-3-enylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene |
|---|---|
| PubChem CID | 77343618 |
| Molecular Formula | C34H38F4O |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-(4-pent-3-enylcyclohexyl)phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene |
| SMILES | CC=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C34H38F4O/c1-3-5-7-9-23-10-12-24(13-11-23)27-18-19-28(32(36)31(27)35)25-14-16-26(17-15-25)29-20-21-30(34(38)33(29)37)39-22-8-6-4-2/h3,5,14-21,23-24H,4,6-13,22H2,1-2H3 |
| InChIKey | DCLMUSVVFDCWFW-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|