C40H46F4O — CID 67740248
1-[4-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene (PubChem CID 67740248) has the molecular formula C40H46F4O and a molecular weight of 618.80 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene.
| Compound Name | 1-[4-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene |
|---|---|
| PubChem CID | 67740248 |
| Molecular Formula | C40H46F4O |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pentoxybenzene |
| SMILES | C/C=C/CCC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(OCCCCC)c(F)c5F)cc4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C40H46F4O/c1-3-5-7-9-27-10-12-28(13-11-27)29-14-16-30(17-15-29)33-22-23-34(38(42)37(33)41)31-18-20-32(21-19-31)35-24-25-36(40(44)39(35)43)45-26-8-6-4-2/h3,5,16,18-25,27-29H,4,6-15,17,26H2,1-2H3/b5-3+ |
| InChIKey | OMWYGONDMNNSDT-HWKANZROSA-N |
| XLogP | 12.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|