C43H52F4O — CID 67740337
1-[4-[2,3-difluoro-4-[4-(4-octylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-3-enoxy]benzene (PubChem CID 67740337) has the molecular formula C43H52F4O and a molecular weight of 660.88 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[4-(4-octylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-3-enoxy]benzene.
| Compound Name | 1-[4-[2,3-difluoro-4-[4-(4-octylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-3-enoxy]benzene |
|---|---|
| PubChem CID | 67740337 |
| Molecular Formula | C43H52F4O |
| Molecular Weight | 660.88 g/mol |
| Exact Mass | 660.40 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[4-(4-octylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-[(Z)-pent-3-enoxy]benzene |
| SMILES | C/C=C\CCOc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CCCCCCCC)CC5)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C43H52F4O/c1-3-5-7-8-9-10-12-30-13-15-31(16-14-30)32-17-19-33(20-18-32)36-25-26-37(41(45)40(36)44)34-21-23-35(24-22-34)38-27-28-39(43(47)42(38)46)48-29-11-6-4-2/h4,6,19,21-28,30-32H,3,5,7-18,20,29H2,1-2H3/b6-4- |
| InChIKey | OPKCAEYALVRFJO-XQRVVYSFSA-N |
| XLogP | 13.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.88 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|