C41H48F4O — CID 67740320
1-[4-[2,3-difluoro-4-[4-(4-hexylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pent-4-enoxybenzene (PubChem CID 67740320) has the molecular formula C41H48F4O and a molecular weight of 632.83 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[4-(4-hexylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pent-4-enoxybenzene.
| Compound Name | 1-[4-[2,3-difluoro-4-[4-(4-hexylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pent-4-enoxybenzene |
|---|---|
| PubChem CID | 67740320 |
| Molecular Formula | C41H48F4O |
| Molecular Weight | 632.83 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[4-(4-hexylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-2,3-difluoro-4-pent-4-enoxybenzene |
| SMILES | C=CCCCOc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CCCCCC)CC5)CC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C41H48F4O/c1-3-5-7-8-10-28-11-13-29(14-12-28)30-15-17-31(18-16-30)34-23-24-35(39(43)38(34)42)32-19-21-33(22-20-32)36-25-26-37(41(45)40(36)44)46-27-9-6-4-2/h4,17,19-26,28-30H,2-3,5-16,18,27H2,1H3 |
| InChIKey | TUXFOLUCZRGYTB-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.83 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|