C38H43F3O — CID 67738928
2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-prop-2-enoxybenzene (PubChem CID 67738928) has the molecular formula C38H43F3O and a molecular weight of 572.76 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-prop-2-enoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 67738928 |
| Molecular Formula | C38H43F3O |
| Molecular Weight | 572.76 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-prop-2-enoxybenzene |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CCCCC)CC5)CC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C38H43F3O/c1-3-5-6-7-26-8-10-27(11-9-26)28-12-14-29(15-13-28)32-20-21-33(35(39)25-32)30-16-18-31(19-17-30)34-22-23-36(42-24-4-2)38(41)37(34)40/h4,14,16-23,25-28H,2-3,5-13,15,24H2,1H3 |
| InChIKey | CWAKHWIEYNQIDR-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.76 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|