C37H39F3O2 — CID 88998401
(E)-4-[4-[4-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]cyclohexyl]but-1-en-1-ol (PubChem CID 88998401) has the molecular formula C37H39F3O2 and a molecular weight of 572.71 g/mol. Its IUPAC name is (E)-4-[4-[4-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]cyclohexyl]but-1-en-1-ol.
| Compound Name | (E)-4-[4-[4-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]cyclohexyl]but-1-en-1-ol |
|---|---|
| PubChem CID | 88998401 |
| Molecular Formula | C37H39F3O2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | (E)-4-[4-[4-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]cyclohex-3-en-1-yl]cyclohexyl]but-1-en-1-ol |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ccc(C4=CCC(C5CCC(CC/C=C/O)CC5)CC4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C37H39F3O2/c1-2-23-42-35-21-20-33(36(39)37(35)40)30-16-14-29(15-17-30)32-19-18-31(24-34(32)38)28-12-10-27(11-13-28)26-8-6-25(7-9-26)5-3-4-22-41/h2,4,12,14-22,24-27,41H,1,3,5-11,13,23H2/b22-4+ |
| InChIKey | PXMQOUVTQJKLFL-LKNXVUQUSA-N |
| XLogP | 10.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|