C39H47F3O — CID 67738953
1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-[4-(4-heptylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene (PubChem CID 67738953) has the molecular formula C39H47F3O and a molecular weight of 588.80 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-[4-(4-heptylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-[4-(4-heptylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 67738953 |
| Molecular Formula | C39H47F3O |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-[4-(4-heptylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]benzene |
| SMILES | CCCCCCCC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(OCC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C39H47F3O/c1-3-5-6-7-8-9-27-10-12-28(13-11-27)29-14-16-30(17-15-29)33-22-23-34(36(40)26-33)31-18-20-32(21-19-31)35-24-25-37(43-4-2)39(42)38(35)41/h16,18-29H,3-15,17H2,1-2H3 |
| InChIKey | XITSEHPKZVHYOJ-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|