C33H37F3O — CID 59609819
1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]benzene (PubChem CID 59609819) has the molecular formula C33H37F3O and a molecular weight of 506.65 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 59609819 |
| Molecular Formula | C33H37F3O |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]benzene |
| SMILES | CCCCCCCC1CC=C(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C33H37F3O/c1-3-5-6-7-8-9-23-10-12-24(13-11-23)27-18-19-28(30(34)22-27)25-14-16-26(17-15-25)29-20-21-31(37-4-2)33(36)32(29)35/h12,14-23H,3-11,13H2,1-2H3 |
| InChIKey | RMFUUYIPMULDTO-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|