C35H39F3O — CID 67731697
2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene (PubChem CID 67731697) has the molecular formula C35H39F3O and a molecular weight of 532.69 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene |
|---|---|
| PubChem CID | 67731697 |
| Molecular Formula | C35H39F3O |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-hexoxybenzene |
| SMILES | C/C=C/CCC1CC=C(c2ccc(-c3ccc(-c4ccc(OCCCCCC)c(F)c4F)cc3)cc2F)CC1 |
| InChI | InChI=1S/C35H39F3O/c1-3-5-7-9-23-39-33-22-21-31(34(37)35(33)38)28-17-15-26(16-18-28)29-19-20-30(32(36)24-29)27-13-11-25(12-14-27)10-8-6-4-2/h4,6,13,15-22,24-25H,3,5,7-12,14,23H2,1-2H3/b6-4+ |
| InChIKey | KQLWRSVKAWGHHC-GQCTYLIASA-N |
| XLogP | 10.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|