C31H31F3O — CID 67731617
1-[4-[4-(4-ethenylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-pentoxybenzene (PubChem CID 67731617) has the molecular formula C31H31F3O and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-[4-[4-(4-ethenylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-pentoxybenzene.
| Compound Name | 1-[4-[4-(4-ethenylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-pentoxybenzene |
|---|---|
| PubChem CID | 67731617 |
| Molecular Formula | C31H31F3O |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 1-[4-[4-(4-ethenylcyclohexen-1-yl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-pentoxybenzene |
| SMILES | C=CC1CC=C(c2ccc(-c3ccc(-c4ccc(OCCCCC)c(F)c4F)cc3)cc2F)CC1 |
| InChI | InChI=1S/C31H31F3O/c1-3-5-6-19-35-29-18-17-27(30(33)31(29)34)24-13-11-22(12-14-24)25-15-16-26(28(32)20-25)23-9-7-21(4-2)8-10-23/h4,9,11-18,20-21H,2-3,5-8,10,19H2,1H3 |
| InChIKey | JZGXXSDXWXTJFD-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|