C34H37F3O — CID 67731642
2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-heptoxybenzene (PubChem CID 67731642) has the molecular formula C34H37F3O and a molecular weight of 518.66 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-heptoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-heptoxybenzene |
|---|---|
| PubChem CID | 67731642 |
| Molecular Formula | C34H37F3O |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexen-1-yl]phenyl]phenyl]-4-heptoxybenzene |
| SMILES | C/C=C/C1CC=C(c2ccc(-c3ccc(-c4ccc(OCCCCCCC)c(F)c4F)cc3)cc2F)CC1 |
| InChI | InChI=1S/C34H37F3O/c1-3-5-6-7-8-22-38-32-21-20-30(33(36)34(32)37)27-16-14-25(15-17-27)28-18-19-29(31(35)23-28)26-12-10-24(9-4-2)11-13-26/h4,9,12,14-21,23-24H,3,5-8,10-11,13,22H2,1-2H3/b9-4+ |
| InChIKey | BXXHLNKOKXDSAS-RUDMXATFSA-N |
| XLogP | 10.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|