C42H51F3O — CID 67739673
2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonoxybenzene (PubChem CID 67739673) has the molecular formula C42H51F3O and a molecular weight of 628.86 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonoxybenzene |
|---|---|
| PubChem CID | 67739673 |
| Molecular Formula | C42H51F3O |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.39 |
| IUPAC Name | 2,3-difluoro-1-[4-[3-fluoro-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonoxybenzene |
| SMILES | C/C=C/C1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(OCCCCCCCCC)c(F)c5F)cc4)cc3F)CC2)CC1 |
| InChI | InChI=1S/C42H51F3O/c1-3-5-6-7-8-9-10-28-46-40-27-26-38(41(44)42(40)45)35-22-18-33(19-23-35)36-24-25-37(39(43)29-36)34-20-16-32(17-21-34)31-14-12-30(11-4-2)13-15-31/h4,11,18-20,22-27,29-32H,3,5-10,12-17,21,28H2,1-2H3/b11-4+ |
| InChIKey | CETKYJNVBFBUQI-NYYWCZLTSA-N |
| XLogP | 13.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|