C36H41F3O — CID 77343719
2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonoxybenzene (PubChem CID 77343719) has the molecular formula C36H41F3O and a molecular weight of 546.72 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonoxybenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonoxybenzene |
|---|---|
| PubChem CID | 77343719 |
| Molecular Formula | C36H41F3O |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-nonoxybenzene |
| SMILES | CC=CC1CC=C(c2ccc(-c3ccc(-c4ccc(OCCCCCCCCC)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C36H41F3O/c1-3-5-6-7-8-9-10-24-40-34-23-22-32(35(38)36(34)39)29-18-16-28(17-19-29)31-21-20-30(25-33(31)37)27-14-12-26(11-4-2)13-15-27/h4,11,14,16-23,25-26H,3,5-10,12-13,15,24H2,1-2H3 |
| InChIKey | HSNKFIKUXVYJSW-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|