C33H35F3 — CID 77343707
2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-hexylbenzene (PubChem CID 77343707) has the molecular formula C33H35F3 and a molecular weight of 488.64 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-hexylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-hexylbenzene |
|---|---|
| PubChem CID | 77343707 |
| Molecular Formula | C33H35F3 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-prop-1-enylcyclohexen-1-yl)phenyl]phenyl]-4-hexylbenzene |
| SMILES | CC=CC1CC=C(c2ccc(-c3ccc(-c4ccc(CCCCCC)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C33H35F3/c1-3-5-6-7-9-27-18-21-30(33(36)32(27)35)26-16-14-25(15-17-26)29-20-19-28(22-31(29)34)24-12-10-23(8-4-2)11-13-24/h4,8,12,14-23H,3,5-7,9-11,13H2,1-2H3 |
| InChIKey | YZSWQFRSRIXTJN-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|