C44H55F3 — CID 67739266
2,3-difluoro-1-[4-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonylbenzene (PubChem CID 67739266) has the molecular formula C44H55F3 and a molecular weight of 640.92 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonylbenzene |
|---|---|
| PubChem CID | 67739266 |
| Molecular Formula | C44H55F3 |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 640.43 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexen-1-yl]phenyl]phenyl]-4-nonylbenzene |
| SMILES | C/C=C/CCC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(CCCCCCCCC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C44H55F3/c1-3-5-7-8-9-10-12-14-38-27-30-41(44(47)43(38)46)37-25-23-36(24-26-37)40-29-28-39(31-42(40)45)35-21-19-34(20-22-35)33-17-15-32(16-18-33)13-11-6-4-2/h4,6,21,23-34H,3,5,7-20,22H2,1-2H3/b6-4+ |
| InChIKey | KHIOHKBPWMWQLU-GQCTYLIASA-N |
| XLogP | 14.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 14.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|