C40H47F3 — CID 77345625
2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pentylbenzene (PubChem CID 77345625) has the molecular formula C40H47F3 and a molecular weight of 584.81 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pentylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pentylbenzene |
|---|---|
| PubChem CID | 77345625 |
| Molecular Formula | C40H47F3 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-[4-(4-pent-3-enylcyclohexyl)cyclohexen-1-yl]phenyl]phenyl]-4-pentylbenzene |
| SMILES | CC=CCCC1CCC(C2CC=C(c3ccc(-c4ccc(-c5ccc(CCCCC)c(F)c5F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C40H47F3/c1-3-5-7-9-28-11-13-29(14-12-28)30-15-17-31(18-16-30)35-24-25-36(38(41)27-35)32-19-21-33(22-20-32)37-26-23-34(10-8-6-4-2)39(42)40(37)43/h3,5,17,19-30H,4,6-16,18H2,1-2H3 |
| InChIKey | FYEZDMLIYCXCTD-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|