C35H38F4 — CID 67732009
1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]benzene (PubChem CID 67732009) has the molecular formula C35H38F4 and a molecular weight of 534.68 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]benzene.
| Compound Name | 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 67732009 |
| Molecular Formula | C35H38F4 |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexen-1-yl]benzene |
| SMILES | C/C=C/CCC1CC=C(c2ccc(-c3ccc(-c4ccc(CCCCCC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C35H38F4/c1-3-5-7-9-11-28-20-21-29(33(37)32(28)36)26-16-18-27(19-17-26)31-23-22-30(34(38)35(31)39)25-14-12-24(13-15-25)10-8-6-4-2/h4,6,14,16-24H,3,5,7-13,15H2,1-2H3/b6-4+ |
| InChIKey | MIYOKSQMSNUXPS-GQCTYLIASA-N |
| XLogP | 11.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|