C21H28F2 — CID 76631767
1-butyl-2,3-difluoro-4-(4-pent-3-enylcyclohexen-1-yl)benzene (PubChem CID 76631767) has the molecular formula C21H28F2 and a molecular weight of 318.45 g/mol. Its IUPAC name is 1-butyl-2,3-difluoro-4-(4-pent-3-enylcyclohexen-1-yl)benzene.
| Compound Name | 1-butyl-2,3-difluoro-4-(4-pent-3-enylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 76631767 |
| Molecular Formula | C21H28F2 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1-butyl-2,3-difluoro-4-(4-pent-3-enylcyclohexen-1-yl)benzene |
| SMILES | CC=CCCC1CC=C(c2ccc(CCCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H28F2/c1-3-5-7-8-16-10-12-17(13-11-16)19-15-14-18(9-6-4-2)20(22)21(19)23/h3,5,12,14-16H,4,6-11,13H2,1-2H3 |
| InChIKey | HVUTVGHUXRTRCY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|