C21H30ClF — CID 59257379
1-butyl-3-chloro-2-fluoro-4-(4-pentylcyclohexen-1-yl)benzene (PubChem CID 59257379) has the molecular formula C21H30ClF and a molecular weight of 336.92 g/mol. Its IUPAC name is 1-butyl-3-chloro-2-fluoro-4-(4-pentylcyclohexen-1-yl)benzene.
| Compound Name | 1-butyl-3-chloro-2-fluoro-4-(4-pentylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 59257379 |
| Molecular Formula | C21H30ClF |
| Molecular Weight | 336.92 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-butyl-3-chloro-2-fluoro-4-(4-pentylcyclohexen-1-yl)benzene |
| SMILES | CCCCCC1CC=C(c2ccc(CCCC)c(F)c2Cl)CC1 |
| InChI | InChI=1S/C21H30ClF/c1-3-5-7-8-16-10-12-17(13-11-16)19-15-14-18(9-6-4-2)21(23)20(19)22/h12,14-16H,3-11,13H2,1-2H3 |
| InChIKey | KYRFCNMLACLJRR-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.92 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|