C24H27ClF2 — CID 59256977
2-chloro-3-fluoro-1-[2-fluoro-4-(4-pentylcyclohexen-1-yl)phenyl]-4-methylbenzene (PubChem CID 59256977) has the molecular formula C24H27ClF2 and a molecular weight of 388.93 g/mol. Its IUPAC name is 2-chloro-3-fluoro-1-[2-fluoro-4-(4-pentylcyclohexen-1-yl)phenyl]-4-methylbenzene.
| Compound Name | 2-chloro-3-fluoro-1-[2-fluoro-4-(4-pentylcyclohexen-1-yl)phenyl]-4-methylbenzene |
|---|---|
| PubChem CID | 59256977 |
| Molecular Formula | C24H27ClF2 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-chloro-3-fluoro-1-[2-fluoro-4-(4-pentylcyclohexen-1-yl)phenyl]-4-methylbenzene |
| SMILES | CCCCCC1CC=C(c2ccc(-c3ccc(C)c(F)c3Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C24H27ClF2/c1-3-4-5-6-17-8-10-18(11-9-17)19-12-14-20(22(26)15-19)21-13-7-16(2)24(27)23(21)25/h7,10,12-15,17H,3-6,8-9,11H2,1-2H3 |
| InChIKey | MTPBOVVRCSCOPR-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|