C32H35F3 — CID 67731127
2,3-difluoro-1-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]-4-methylbenzene (PubChem CID 67731127) has the molecular formula C32H35F3 and a molecular weight of 476.63 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]-4-methylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]-4-methylbenzene |
|---|---|
| PubChem CID | 67731127 |
| Molecular Formula | C32H35F3 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-fluoro-4-(4-heptylcyclohexen-1-yl)phenyl]phenyl]-4-methylbenzene |
| SMILES | CCCCCCCC1CC=C(c2ccc(-c3ccc(-c4ccc(C)c(F)c4F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C32H35F3/c1-3-4-5-6-7-8-23-10-12-24(13-11-23)27-18-20-28(30(33)21-27)25-14-16-26(17-15-25)29-19-9-22(2)31(34)32(29)35/h9,12,14-21,23H,3-8,10-11,13H2,1-2H3 |
| InChIKey | ULNBQGSSCHJWHZ-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|