C17H22BrF — CID 58687490
4-bromo-2-fluoro-1-(4-pentylcyclohexen-1-yl)benzene (PubChem CID 58687490) has the molecular formula C17H22BrF and a molecular weight of 325.26 g/mol. Its IUPAC name is 4-bromo-2-fluoro-1-(4-pentylcyclohexen-1-yl)benzene.
| Compound Name | 4-bromo-2-fluoro-1-(4-pentylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 58687490 |
| Molecular Formula | C17H22BrF |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-bromo-2-fluoro-1-(4-pentylcyclohexen-1-yl)benzene |
| SMILES | CCCCCC1CC=C(c2ccc(Br)cc2F)CC1 |
| InChI | InChI=1S/C17H22BrF/c1-2-3-4-5-13-6-8-14(9-7-13)16-11-10-15(18)12-17(16)19/h8,10-13H,2-7,9H2,1H3 |
| InChIKey | KWDPNPVCQGEUKZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|