C15H20BrFN2 — CID 71006132
(5S)-2-(4-bromo-2-fluorophenyl)-5-pentyl-1,4,5,6-tetrahydropyrimidine (PubChem CID 71006132) has the molecular formula C15H20BrFN2 and a molecular weight of 327.24 g/mol. Its IUPAC name is (5S)-2-(4-bromo-2-fluorophenyl)-5-pentyl-1,4,5,6-tetrahydropyrimidine.
| Compound Name | (5S)-2-(4-bromo-2-fluorophenyl)-5-pentyl-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 71006132 |
| Molecular Formula | C15H20BrFN2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (5S)-2-(4-bromo-2-fluorophenyl)-5-pentyl-1,4,5,6-tetrahydropyrimidine |
| SMILES | CCCCC[C@@H]1CN=C(c2ccc(Br)cc2F)NC1 |
| InChI | InChI=1S/C15H20BrFN2/c1-2-3-4-5-11-9-18-15(19-10-11)13-7-6-12(16)8-14(13)17/h6-8,11H,2-5,9-10H2,1H3,(H,18,19) |
| InChIKey | VUQNSVMFDGKDPO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|