C14H17BrO2 — CID 114673094
7-bromo-2-pentyl-2,3-dihydrochromen-4-one (PubChem CID 114673094) has the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. Its IUPAC name is 7-bromo-2-pentyl-2,3-dihydrochromen-4-one.
| Compound Name | 7-bromo-2-pentyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114673094 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 7-bromo-2-pentyl-2,3-dihydrochromen-4-one |
| SMILES | CCCCCC1CC(=O)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C14H17BrO2/c1-2-3-4-5-11-9-13(16)12-7-6-10(15)8-14(12)17-11/h6-8,11H,2-5,9H2,1H3 |
| InChIKey | BVWAOHOUYLVFEX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|