About 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one
7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one (PubChem CID 114673148) has the molecular formula C17H15BrO2
and a molecular weight of 331.21 g/mol. Its IUPAC name is 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one |
| PubChem CID | 114673148 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one |
| SMILES | Cc1cccc(C)c1C1CC(=O)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C17H15BrO2/c1-10-4-3-5-11(2)17(10)16-9-14(19)13-7-6-12(18)8-15(13)20-16/h3-8,16H,9H2,1-2H3 |
| InChIKey | PDRPLZHLACSXJS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one?
The IUPAC name of 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one (CID 114673148) is 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one?
The canonical SMILES for 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one is Cc1cccc(C)c1C1CC(=O)c2ccc(Br)cc2O1.
What is the InChIKey of 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one?
The InChIKey is PDRPLZHLACSXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrO2/c1-10-4-3-5-11(2)17(10)16-9-14(19)13-7-6-12(18)8-15(13)20-16/h3-8,16H,9H2,1-2H3.
What are the key properties of 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one?
7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one has a molecular weight of 331.21 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-(2,6-dimethylphenyl)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 114673148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).