C13H9BrO2S — CID 114673268
7-bromo-2-thiophen-3-yl-2,3-dihydrochromen-4-one (PubChem CID 114673268) has the molecular formula C13H9BrO2S and a molecular weight of 309.18 g/mol. Its IUPAC name is 7-bromo-2-thiophen-3-yl-2,3-dihydrochromen-4-one.
| Compound Name | 7-bromo-2-thiophen-3-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114673268 |
| Molecular Formula | C13H9BrO2S |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | 7-bromo-2-thiophen-3-yl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccsc2)Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H9BrO2S/c14-9-1-2-10-11(15)6-12(16-13(10)5-9)8-3-4-17-7-8/h1-5,7,12H,6H2 |
| InChIKey | IWJDKULRQXPKSF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |