C15H8BrF3O2 — CID 114674398
6-bromo-2-(3,4,5-trifluorophenyl)-2,3-dihydrochromen-4-one (PubChem CID 114674398) has the molecular formula C15H8BrF3O2 and a molecular weight of 357.13 g/mol. Its IUPAC name is 6-bromo-2-(3,4,5-trifluorophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-bromo-2-(3,4,5-trifluorophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114674398 |
| Molecular Formula | C15H8BrF3O2 |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 6-bromo-2-(3,4,5-trifluorophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2cc(F)c(F)c(F)c2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H8BrF3O2/c16-8-1-2-13-9(5-8)12(20)6-14(21-13)7-3-10(17)15(19)11(18)4-7/h1-5,14H,6H2 |
| InChIKey | KLOKYDDQOZRIEK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|