C15H9ClF2O2 — CID 106534728
6-chloro-2-(3,5-difluorophenyl)-2,3-dihydrochromen-4-one (PubChem CID 106534728) has the molecular formula C15H9ClF2O2 and a molecular weight of 294.68 g/mol. Its IUPAC name is 6-chloro-2-(3,5-difluorophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-chloro-2-(3,5-difluorophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 106534728 |
| Molecular Formula | C15H9ClF2O2 |
| Molecular Weight | 294.68 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 6-chloro-2-(3,5-difluorophenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2cc(F)cc(F)c2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H9ClF2O2/c16-9-1-2-14-12(5-9)13(19)7-15(20-14)8-3-10(17)6-11(18)4-8/h1-6,15H,7H2 |
| InChIKey | NDVMNZDBPGODPB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |