C15H12ClNO2 — CID 82046236
6-amino-2-(4-chlorophenyl)-2,3-dihydrochromen-4-one (PubChem CID 82046236) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 6-amino-2-(4-chlorophenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 6-amino-2-(4-chlorophenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 82046236 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 6-amino-2-(4-chlorophenyl)-2,3-dihydrochromen-4-one |
| SMILES | Nc1ccc2c(c1)C(=O)CC(c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C15H12ClNO2/c16-10-3-1-9(2-4-10)15-8-13(18)12-7-11(17)5-6-14(12)19-15/h1-7,15H,8,17H2 |
| InChIKey | PCALOOXHZOOEPD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|