C15H12O4 — CID 77105169
(2S)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 77105169) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2S)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 77105169 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (2S)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)15-8-13(18)12-7-11(17)5-6-14(12)19-15/h1-7,15-17H,8H2/t15-/m0/s1 |
| InChIKey | MDGCNPDCAJHUOC-HNNXBMFYSA-N |
| XLogP | 2.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |