C32H26N2O4 — CID 123383733
(6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide;6-methyl-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 123383733) has the molecular formula C32H26N2O4 and a molecular weight of 502.57 g/mol. Its IUPAC name is (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide;6-methyl-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide;6-methyl-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 123383733 |
| Molecular Formula | C32H26N2O4 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (6-hydroxy-2-phenyl-2,3-dihydrochromen-4-ylidene)cyanamide;6-methyl-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)CC(c1ccccc1)O2.N#C/N=C1\CC(c2ccccc2)Oc2ccc(O)cc21 |
| InChI | InChI=1S/C16H12N2O2.C16H14O2/c17-10-18-14-9-16(11-4-2-1-3-5-11)20-15-7-6-12(19)8-13(14)15;1-11-7-8-15-13(9-11)14(17)10-16(18-15)12-5-3-2-4-6-12/h1-8,16,19H,9H2;2-9,16H,10H2,1H3/b18-14+; |
| InChIKey | IARRNKLOMQNYND-LSJACRKWSA-N |
| XLogP | 6.89 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|