C23H36O2 — CID 91018475
ethane;2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 91018475) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is ethane;2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | ethane;2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91018475 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | ethane;2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CC.CC.CC.CC.O=C1CC(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C15H12O2.4C2H6/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;4*1-2/h1-9,15H,10H2;4*1-2H3 |
| InChIKey | BOYOJNSRXNDGLS-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |