C16H11NO2 — CID 25136970
4-[(2R)-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile (PubChem CID 25136970) has the molecular formula C16H11NO2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-[(2R)-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile.
| Compound Name | 4-[(2R)-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 25136970 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 4-[(2R)-4-oxo-2,3-dihydrochromen-2-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@H]2CC(=O)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C16H11NO2/c17-10-11-5-7-12(8-6-11)16-9-14(18)13-3-1-2-4-15(13)19-16/h1-8,16H,9H2/t16-/m1/s1 |
| InChIKey | UGADJEONUBLFNT-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |