C16H11F3O2 — CID 114671510
2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one (PubChem CID 114671510) has the molecular formula C16H11F3O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114671510 |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2cccc(C(F)(F)F)c2)Oc2ccccc21 |
| InChI | InChI=1S/C16H11F3O2/c17-16(18,19)11-5-3-4-10(8-11)15-9-13(20)12-6-1-2-7-14(12)21-15/h1-8,15H,9H2 |
| InChIKey | FTDRQAVHCWDJPV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |