C10H7F3O3 — CID 102125689
4-[3-(trifluoromethyl)phenyl]-1,3-dioxolan-2-one (PubChem CID 102125689) has the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[3-(trifluoromethyl)phenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 102125689 |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(c2cccc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C10H7F3O3/c11-10(12,13)7-3-1-2-6(4-7)8-5-15-9(14)16-8/h1-4,8H,5H2 |
| InChIKey | BPBUEGGLCWRDAH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |