C18H16O6 — CID 160714565
4-phenyl-1,3-dioxolan-2-one (PubChem CID 160714565) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 4-phenyl-1,3-dioxolan-2-one.
| Compound Name | 4-phenyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 160714565 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-phenyl-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(c2ccccc2)O1.O=C1OCC(c2ccccc2)O1 |
| InChI | InChI=1S/2C9H8O3/c2*10-9-11-6-8(12-9)7-4-2-1-3-5-7/h2*1-5,8H,6H2 |
| InChIKey | RSHMEDZALNMSLG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |