About 4-phenyl-1,3-dioxolan-2-one
4-phenyl-1,3-dioxolan-2-one (PubChem CID 160714565) has the molecular formula C18H16O6
and a molecular weight of 328.32 g/mol. Its IUPAC name is 4-phenyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-phenyl-1,3-dioxolan-2-one |
| PubChem CID | 160714565 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-phenyl-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(c2ccccc2)O1.O=C1OCC(c2ccccc2)O1 |
| InChI | InChI=1S/2C9H8O3/c2*10-9-11-6-8(12-9)7-4-2-1-3-5-7/h2*1-5,8H,6H2 |
| InChIKey | RSHMEDZALNMSLG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-phenyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1,3-dioxolan-2-one?
The IUPAC name of 4-phenyl-1,3-dioxolan-2-one (CID 160714565) is 4-phenyl-1,3-dioxolan-2-one.
What is the SMILES notation for 4-phenyl-1,3-dioxolan-2-one?
The canonical SMILES for 4-phenyl-1,3-dioxolan-2-one is O=C1OCC(c2ccccc2)O1.O=C1OCC(c2ccccc2)O1.
What is the InChIKey of 4-phenyl-1,3-dioxolan-2-one?
The InChIKey is RSHMEDZALNMSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H8O3/c2*10-9-11-6-8(12-9)7-4-2-1-3-5-7/h2*1-5,8H,6H2.
What are the key properties of 4-phenyl-1,3-dioxolan-2-one?
4-phenyl-1,3-dioxolan-2-one has a molecular weight of 328.32 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1,3-dioxolan-2-one is sourced from PubChem (CID 160714565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).