C8H8O3S — CID 10921184
(2R,4S)-4-phenyl-1,3,2-dioxathiolane 2-oxide (PubChem CID 10921184) has the molecular formula C8H8O3S and a molecular weight of 184.22 g/mol. Its IUPAC name is (2R,4S)-4-phenyl-1,3,2-dioxathiolane 2-oxide.
| Compound Name | (2R,4S)-4-phenyl-1,3,2-dioxathiolane 2-oxide |
|---|---|
| PubChem CID | 10921184 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | (2R,4S)-4-phenyl-1,3,2-dioxathiolane 2-oxide |
| SMILES | O=[S@@]1OC[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C8H8O3S/c9-12-10-6-8(11-12)7-4-2-1-3-5-7/h1-5,8H,6H2/t8-,12-/m1/s1 |
| InChIKey | ZGYVHBFAOMTCHT-PRHODGIISA-N |
| XLogP | 1.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |