C10H10O3 — CID 101083967
(5S)-5-phenyl-1,4-dioxan-2-one (PubChem CID 101083967) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (5S)-5-phenyl-1,4-dioxan-2-one.
| Compound Name | (5S)-5-phenyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 101083967 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (5S)-5-phenyl-1,4-dioxan-2-one |
| SMILES | O=C1CO[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C10H10O3/c11-10-7-12-9(6-13-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m1/s1 |
| InChIKey | ISMJDTGDJASKHW-SECBINFHSA-N |
| XLogP | 1.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |