About 5-phenyloxolan-2-one
5-phenyloxolan-2-one (PubChem CID 13884) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-phenyloxolan-2-one.
Molecular Properties
| Compound Name | 5-phenyloxolan-2-one |
| PubChem CID | 13884 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 5-phenyloxolan-2-one |
| SMILES | O=C1CCC(c2ccccc2)O1 |
| InChI | InChI=1S/C10H10O2/c11-10-7-6-9(12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | AEUULUMEYIPECD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyloxolan-2-one?
The IUPAC name of 5-phenyloxolan-2-one (CID 13884) is 5-phenyloxolan-2-one.
What is the SMILES notation for 5-phenyloxolan-2-one?
The canonical SMILES for 5-phenyloxolan-2-one is O=C1CCC(c2ccccc2)O1.
What is the InChIKey of 5-phenyloxolan-2-one?
The InChIKey is AEUULUMEYIPECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c11-10-7-6-9(12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of 5-phenyloxolan-2-one?
5-phenyloxolan-2-one has a molecular weight of 162.19 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyloxolan-2-one is sourced from PubChem (CID 13884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).